C27H39NO6 — CID 142629384
[1-(1,4,5,8-tetramethoxynaphthalen-2-yl)propylideneamino] decanoate (PubChem CID 142629384) has the molecular formula C27H39NO6 and a molecular weight of 473.61 g/mol. Its IUPAC name is [1-(1,4,5,8-tetramethoxynaphthalen-2-yl)propylideneamino] decanoate.
| Compound Name | [1-(1,4,5,8-tetramethoxynaphthalen-2-yl)propylideneamino] decanoate |
|---|---|
| PubChem CID | 142629384 |
| Molecular Formula | C27H39NO6 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | [1-(1,4,5,8-tetramethoxynaphthalen-2-yl)propylideneamino] decanoate |
| SMILES | CCCCCCCCCC(=O)ON=C(CC)c1cc(OC)c2c(OC)ccc(OC)c2c1OC |
| InChI | InChI=1S/C27H39NO6/c1-7-9-10-11-12-13-14-15-24(29)34-28-20(8-2)19-18-23(32-5)25-21(30-3)16-17-22(31-4)26(25)27(19)33-6/h16-18H,7-15H2,1-6H3 |
| InChIKey | CEQMZQHTROYASB-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|