C24H28N2O5S2 — CID 11684557
[(Z)-[2-(1,3-benzothiazol-2-ylsulfanyl)-1-(2,3,4-trimethoxyphenyl)ethylidene]amino] hexanoate (PubChem CID 11684557) has the molecular formula C24H28N2O5S2 and a molecular weight of 488.63 g/mol. Its IUPAC name is [(Z)-[2-(1,3-benzothiazol-2-ylsulfanyl)-1-(2,3,4-trimethoxyphenyl)ethylidene]amino] hexanoate.
| Compound Name | [(Z)-[2-(1,3-benzothiazol-2-ylsulfanyl)-1-(2,3,4-trimethoxyphenyl)ethylidene]amino] hexanoate |
|---|---|
| PubChem CID | 11684557 |
| Molecular Formula | C24H28N2O5S2 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | [(Z)-[2-(1,3-benzothiazol-2-ylsulfanyl)-1-(2,3,4-trimethoxyphenyl)ethylidene]amino] hexanoate |
| SMILES | CCCCCC(=O)O/N=C(\CSc1nc2ccccc2s1)c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C24H28N2O5S2/c1-5-6-7-12-21(27)31-26-18(15-32-24-25-17-10-8-9-11-20(17)33-24)16-13-14-19(28-2)23(30-4)22(16)29-3/h8-11,13-14H,5-7,12,15H2,1-4H3/b26-18+ |
| InChIKey | MAPSDRYVBAPQKO-NLRVBDNBSA-N |
| XLogP | 5.94 |
| TPSA | 79.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|