C22H24N2O5S2 — CID 11539867
[(Z)-[2-(1,3-benzothiazol-2-ylsulfanyl)-1-(2,3,4-trimethoxyphenyl)ethylidene]amino] butanoate (PubChem CID 11539867) has the molecular formula C22H24N2O5S2 and a molecular weight of 460.58 g/mol. Its IUPAC name is [(Z)-[2-(1,3-benzothiazol-2-ylsulfanyl)-1-(2,3,4-trimethoxyphenyl)ethylidene]amino] butanoate.
| Compound Name | [(Z)-[2-(1,3-benzothiazol-2-ylsulfanyl)-1-(2,3,4-trimethoxyphenyl)ethylidene]amino] butanoate |
|---|---|
| PubChem CID | 11539867 |
| Molecular Formula | C22H24N2O5S2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | [(Z)-[2-(1,3-benzothiazol-2-ylsulfanyl)-1-(2,3,4-trimethoxyphenyl)ethylidene]amino] butanoate |
| SMILES | CCCC(=O)O/N=C(\CSc1nc2ccccc2s1)c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C22H24N2O5S2/c1-5-8-19(25)29-24-16(13-30-22-23-15-9-6-7-10-18(15)31-22)14-11-12-17(26-2)21(28-4)20(14)27-3/h6-7,9-12H,5,8,13H2,1-4H3/b24-16+ |
| InChIKey | KKTHWCKOJIQWNW-LFVJCYFKSA-N |
| XLogP | 5.16 |
| TPSA | 79.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|