C23H36O6 — CID 153405800
butyl 2-(2,3,4-trimethoxy-6-octanoylphenyl)acetate (PubChem CID 153405800) has the molecular formula C23H36O6 and a molecular weight of 408.54 g/mol. Its IUPAC name is butyl 2-(2,3,4-trimethoxy-6-octanoylphenyl)acetate.
| Compound Name | butyl 2-(2,3,4-trimethoxy-6-octanoylphenyl)acetate |
|---|---|
| PubChem CID | 153405800 |
| Molecular Formula | C23H36O6 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | butyl 2-(2,3,4-trimethoxy-6-octanoylphenyl)acetate |
| SMILES | CCCCCCCC(=O)c1cc(OC)c(OC)c(OC)c1CC(=O)OCCCC |
| InChI | InChI=1S/C23H36O6/c1-6-8-10-11-12-13-19(24)17-15-20(26-3)23(28-5)22(27-4)18(17)16-21(25)29-14-9-7-2/h15H,6-14,16H2,1-5H3 |
| InChIKey | JCDIPTUQYCWJKI-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|