C25H28ClNO6 — CID 10719290
ethyl 2-(chloromethyl)-4-(3,4-dimethoxyphenyl)-7-methoxy-6-propan-2-yloxyquinoline-3-carboxylate (PubChem CID 10719290) has the molecular formula C25H28ClNO6 and a molecular weight of 473.95 g/mol. Its IUPAC name is ethyl 2-(chloromethyl)-4-(3,4-dimethoxyphenyl)-7-methoxy-6-propan-2-yloxyquinoline-3-carboxylate.
| Compound Name | ethyl 2-(chloromethyl)-4-(3,4-dimethoxyphenyl)-7-methoxy-6-propan-2-yloxyquinoline-3-carboxylate |
|---|---|
| PubChem CID | 10719290 |
| Molecular Formula | C25H28ClNO6 |
| Molecular Weight | 473.95 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | ethyl 2-(chloromethyl)-4-(3,4-dimethoxyphenyl)-7-methoxy-6-propan-2-yloxyquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(CCl)nc2cc(OC)c(OC(C)C)cc2c1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C25H28ClNO6/c1-7-32-25(28)24-18(13-26)27-17-12-21(31-6)22(33-14(2)3)11-16(17)23(24)15-8-9-19(29-4)20(10-15)30-5/h8-12,14H,7,13H2,1-6H3 |
| InChIKey | LNSVYUBTFMIVQE-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.95 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|