C12H15N3O4 — CID 54502475
ethyl 3-amino-5,6-dimethoxyindazole-2-carboxylate (PubChem CID 54502475) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is ethyl 3-amino-5,6-dimethoxyindazole-2-carboxylate.
| Compound Name | ethyl 3-amino-5,6-dimethoxyindazole-2-carboxylate |
|---|---|
| PubChem CID | 54502475 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | ethyl 3-amino-5,6-dimethoxyindazole-2-carboxylate |
| SMILES | CCOC(=O)n1nc2cc(OC)c(OC)cc2c1N |
| InChI | InChI=1S/C12H15N3O4/c1-4-19-12(16)15-11(13)7-5-9(17-2)10(18-3)6-8(7)14-15/h5-6H,4,13H2,1-3H3 |
| InChIKey | YDKDPCUQIWVJOV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |