C16H21N3O5 — CID 10735519
ethyl 4-(5-amino-6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate (PubChem CID 10735519) has the molecular formula C16H21N3O5 and a molecular weight of 335.36 g/mol. Its IUPAC name is ethyl 4-(5-amino-6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate.
| Compound Name | ethyl 4-(5-amino-6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate |
|---|---|
| PubChem CID | 10735519 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | ethyl 4-(5-amino-6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate |
| SMILES | CCOC(=O)CCCn1cnc2cc(OC)c(OC)c(N)c2c1=O |
| InChI | InChI=1S/C16H21N3O5/c1-4-24-12(20)6-5-7-19-9-18-10-8-11(22-2)15(23-3)14(17)13(10)16(19)21/h8-9H,4-7,17H2,1-3H3 |
| InChIKey | FMROUKPWTDHLDR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|