About ethyl 4-(5-amino-6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate
ethyl 4-(5-amino-6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate (PubChem CID 10735519) has the molecular formula C16H21N3O5
and a molecular weight of 335.36 g/mol. Its IUPAC name is ethyl 4-(5-amino-6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate.
Molecular Properties
| Compound Name | ethyl 4-(5-amino-6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate |
| PubChem CID | 10735519 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | ethyl 4-(5-amino-6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate |
| SMILES | CCOC(=O)CCCn1cnc2cc(OC)c(OC)c(N)c2c1=O |
| InChI | InChI=1S/C16H21N3O5/c1-4-24-12(20)6-5-7-19-9-18-10-8-11(22-2)15(23-3)14(17)13(10)16(19)21/h8-9H,4-7,17H2,1-3H3 |
| InChIKey | FMROUKPWTDHLDR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-(5-amino-6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(5-amino-6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate?
The IUPAC name of ethyl 4-(5-amino-6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate (CID 10735519) is ethyl 4-(5-amino-6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate.
What is the SMILES notation for ethyl 4-(5-amino-6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate?
The canonical SMILES for ethyl 4-(5-amino-6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate is CCOC(=O)CCCn1cnc2cc(OC)c(OC)c(N)c2c1=O.
What is the InChIKey of ethyl 4-(5-amino-6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate?
The InChIKey is FMROUKPWTDHLDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O5/c1-4-24-12(20)6-5-7-19-9-18-10-8-11(22-2)15(23-3)14(17)13(10)16(19)21/h8-9H,4-7,17H2,1-3H3.
What are the key properties of ethyl 4-(5-amino-6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate?
ethyl 4-(5-amino-6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate has a molecular weight of 335.36 g/mol, XLogP of 1.34, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(5-amino-6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate is sourced from PubChem (CID 10735519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).