C23H26N2O5 — CID 51476992
(2,3,6-trimethylphenyl) 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate (PubChem CID 51476992) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is (2,3,6-trimethylphenyl) 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate.
| Compound Name | (2,3,6-trimethylphenyl) 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate |
|---|---|
| PubChem CID | 51476992 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | (2,3,6-trimethylphenyl) 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate |
| SMILES | COc1cc2ncn(CCCC(=O)Oc3c(C)ccc(C)c3C)c(=O)c2cc1OC |
| InChI | InChI=1S/C23H26N2O5/c1-14-8-9-15(2)22(16(14)3)30-21(26)7-6-10-25-13-24-18-12-20(29-5)19(28-4)11-17(18)23(25)27/h8-9,11-13H,6-7,10H2,1-5H3 |
| InChIKey | FTVRXLGIZICHPS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|