C20H18BrFN2O5 — CID 55456037
(4-bromo-2-fluorophenyl) 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate (PubChem CID 55456037) has the molecular formula C20H18BrFN2O5 and a molecular weight of 465.28 g/mol. Its IUPAC name is (4-bromo-2-fluorophenyl) 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate.
| Compound Name | (4-bromo-2-fluorophenyl) 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate |
|---|---|
| PubChem CID | 55456037 |
| Molecular Formula | C20H18BrFN2O5 |
| Molecular Weight | 465.28 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | (4-bromo-2-fluorophenyl) 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate |
| SMILES | COc1cc2ncn(CCCC(=O)Oc3ccc(Br)cc3F)c(=O)c2cc1OC |
| InChI | InChI=1S/C20H18BrFN2O5/c1-27-17-9-13-15(10-18(17)28-2)23-11-24(20(13)26)7-3-4-19(25)29-16-6-5-12(21)8-14(16)22/h5-6,8-11H,3-4,7H2,1-2H3 |
| InChIKey | FTGBYWPYXYJJSY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.28 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|