C23H25FN4O6 — CID 46657662
4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-N'-[2-(4-fluorophenoxy)propanoyl]butanehydrazide (PubChem CID 46657662) has the molecular formula C23H25FN4O6 and a molecular weight of 472.47 g/mol. Its IUPAC name is 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-N'-[2-(4-fluorophenoxy)propanoyl]butanehydrazide.
| Compound Name | 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-N'-[2-(4-fluorophenoxy)propanoyl]butanehydrazide |
|---|---|
| PubChem CID | 46657662 |
| Molecular Formula | C23H25FN4O6 |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-N'-[2-(4-fluorophenoxy)propanoyl]butanehydrazide |
| SMILES | COc1cc2ncn(CCCC(=O)NNC(=O)C(C)Oc3ccc(F)cc3)c(=O)c2cc1OC |
| InChI | InChI=1S/C23H25FN4O6/c1-14(34-16-8-6-15(24)7-9-16)22(30)27-26-21(29)5-4-10-28-13-25-18-12-20(33-3)19(32-2)11-17(18)23(28)31/h6-9,11-14H,4-5,10H2,1-3H3,(H,26,29)(H,27,30) |
| InChIKey | WTCNMVHWBHPUQW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|