About [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate
[2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate (PubChem CID 55471463) has the molecular formula C24H27N3O6S
and a molecular weight of 485.56 g/mol. Its IUPAC name is [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate.
Molecular Properties
| Compound Name | [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate |
| PubChem CID | 55471463 |
| Molecular Formula | C24H27N3O6S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate |
| SMILES | COc1cc2ncn(CCCC(=O)OCC(=O)N3CCCC3c3cccs3)c(=O)c2cc1OC |
| InChI | InChI=1S/C24H27N3O6S/c1-31-19-12-16-17(13-20(19)32-2)25-15-26(24(16)30)9-4-8-23(29)33-14-22(28)27-10-3-6-18(27)21-7-5-11-34-21/h5,7,11-13,15,18H,3-4,6,8-10,14H2,1-2H3 |
| InChIKey | SQUMBHQGKCSTBT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 99.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate?
The IUPAC name of [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate (CID 55471463) is [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate.
What is the SMILES notation for [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate?
The canonical SMILES for [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate is COc1cc2ncn(CCCC(=O)OCC(=O)N3CCCC3c3cccs3)c(=O)c2cc1OC.
What is the InChIKey of [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate?
The InChIKey is SQUMBHQGKCSTBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27N3O6S/c1-31-19-12-16-17(13-20(19)32-2)25-15-26(24(16)30)9-4-8-23(29)33-14-22(28)27-10-3-6-18(27)21-7-5-11-34-21/h5,7,11-13,15,18H,3-4,6,8-10,14H2,1-2H3.
What are the key properties of [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate?
[2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate has a molecular weight of 485.56 g/mol, XLogP of 3.16, 9 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoate is sourced from PubChem (CID 55471463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).