C18H18ClNO4S — CID 55371401
[2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 2-(2-chlorophenoxy)acetate (PubChem CID 55371401) has the molecular formula C18H18ClNO4S and a molecular weight of 379.87 g/mol. Its IUPAC name is [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 2-(2-chlorophenoxy)acetate.
| Compound Name | [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 2-(2-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 55371401 |
| Molecular Formula | C18H18ClNO4S |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 2-(2-chlorophenoxy)acetate |
| SMILES | O=C(COc1ccccc1Cl)OCC(=O)N1CCCC1c1cccs1 |
| InChI | InChI=1S/C18H18ClNO4S/c19-13-5-1-2-7-15(13)23-12-18(22)24-11-17(21)20-9-3-6-14(20)16-8-4-10-25-16/h1-2,4-5,7-8,10,14H,3,6,9,11-12H2 |
| InChIKey | OGHKUOBGMUUZEH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |