C17H22ClNO4 — CID 23904804
[2-(2-ethylpiperidin-1-yl)-2-oxoethyl] 2-(2-chlorophenoxy)acetate (PubChem CID 23904804) has the molecular formula C17H22ClNO4 and a molecular weight of 339.82 g/mol. Its IUPAC name is [2-(2-ethylpiperidin-1-yl)-2-oxoethyl] 2-(2-chlorophenoxy)acetate.
| Compound Name | [2-(2-ethylpiperidin-1-yl)-2-oxoethyl] 2-(2-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 23904804 |
| Molecular Formula | C17H22ClNO4 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | [2-(2-ethylpiperidin-1-yl)-2-oxoethyl] 2-(2-chlorophenoxy)acetate |
| SMILES | CCC1CCCCN1C(=O)COC(=O)COc1ccccc1Cl |
| InChI | InChI=1S/C17H22ClNO4/c1-2-13-7-5-6-10-19(13)16(20)11-23-17(21)12-22-15-9-4-3-8-14(15)18/h3-4,8-9,13H,2,5-7,10-12H2,1H3 |
| InChIKey | QCOYECOMPQOMTM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |