C16H18Cl3NO3 — CID 55304080
[2-(2-ethylpiperidin-1-yl)-2-oxoethyl] 2,3,6-trichlorobenzoate (PubChem CID 55304080) has the molecular formula C16H18Cl3NO3 and a molecular weight of 378.68 g/mol. Its IUPAC name is [2-(2-ethylpiperidin-1-yl)-2-oxoethyl] 2,3,6-trichlorobenzoate.
| Compound Name | [2-(2-ethylpiperidin-1-yl)-2-oxoethyl] 2,3,6-trichlorobenzoate |
|---|---|
| PubChem CID | 55304080 |
| Molecular Formula | C16H18Cl3NO3 |
| Molecular Weight | 378.68 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | [2-(2-ethylpiperidin-1-yl)-2-oxoethyl] 2,3,6-trichlorobenzoate |
| SMILES | CCC1CCCCN1C(=O)COC(=O)c1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C16H18Cl3NO3/c1-2-10-5-3-4-8-20(10)13(21)9-23-16(22)14-11(17)6-7-12(18)15(14)19/h6-7,10H,2-5,8-9H2,1H3 |
| InChIKey | HACHKBSQKDQTSB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.68 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|