C17H23NO4 — CID 2371514
[2-[(2R)-2-ethylpiperidin-1-yl]-2-oxoethyl] 4-methoxybenzoate (PubChem CID 2371514) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is [2-[(2R)-2-ethylpiperidin-1-yl]-2-oxoethyl] 4-methoxybenzoate.
| Compound Name | [2-[(2R)-2-ethylpiperidin-1-yl]-2-oxoethyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 2371514 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | [2-[(2R)-2-ethylpiperidin-1-yl]-2-oxoethyl] 4-methoxybenzoate |
| SMILES | CC[C@@H]1CCCCN1C(=O)COC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H23NO4/c1-3-14-6-4-5-11-18(14)16(19)12-22-17(20)13-7-9-15(21-2)10-8-13/h7-10,14H,3-6,11-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | CMFOWUNOILRBBL-CQSZACIVSA-N |
| XLogP | 2.64 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |