C22H25NO4 — CID 7133637
[2-[(2S)-2-ethylpiperidin-1-yl]-2-oxoethyl] 4-(4-hydroxyphenyl)benzoate (PubChem CID 7133637) has the molecular formula C22H25NO4 and a molecular weight of 367.44 g/mol. Its IUPAC name is [2-[(2S)-2-ethylpiperidin-1-yl]-2-oxoethyl] 4-(4-hydroxyphenyl)benzoate.
| Compound Name | [2-[(2S)-2-ethylpiperidin-1-yl]-2-oxoethyl] 4-(4-hydroxyphenyl)benzoate |
|---|---|
| PubChem CID | 7133637 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | [2-[(2S)-2-ethylpiperidin-1-yl]-2-oxoethyl] 4-(4-hydroxyphenyl)benzoate |
| SMILES | CC[C@H]1CCCCN1C(=O)COC(=O)c1ccc(-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C22H25NO4/c1-2-19-5-3-4-14-23(19)21(25)15-27-22(26)18-8-6-16(7-9-18)17-10-12-20(24)13-11-17/h6-13,19,24H,2-5,14-15H2,1H3/t19-/m0/s1 |
| InChIKey | FJJNNRACXSRWBL-IBGZPJMESA-N |
| XLogP | 4.01 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |