C23H25NO4 — CID 7203935
[2-[(2R)-2-ethylpiperidin-1-yl]-2-oxoethyl] 4-benzoylbenzoate (PubChem CID 7203935) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is [2-[(2R)-2-ethylpiperidin-1-yl]-2-oxoethyl] 4-benzoylbenzoate.
| Compound Name | [2-[(2R)-2-ethylpiperidin-1-yl]-2-oxoethyl] 4-benzoylbenzoate |
|---|---|
| PubChem CID | 7203935 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | [2-[(2R)-2-ethylpiperidin-1-yl]-2-oxoethyl] 4-benzoylbenzoate |
| SMILES | CC[C@@H]1CCCCN1C(=O)COC(=O)c1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H25NO4/c1-2-20-10-6-7-15-24(20)21(25)16-28-23(27)19-13-11-18(12-14-19)22(26)17-8-4-3-5-9-17/h3-5,8-9,11-14,20H,2,6-7,10,15-16H2,1H3/t20-/m1/s1 |
| InChIKey | HARAEIGBDPCATN-HXUWFJFHSA-N |
| XLogP | 3.87 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |