C20H29ClN2O5S — CID 46791269
[2-(2-ethylpiperidin-1-yl)-2-oxoethyl] 3-(tert-butylsulfamoyl)-4-chlorobenzoate (PubChem CID 46791269) has the molecular formula C20H29ClN2O5S and a molecular weight of 444.98 g/mol. Its IUPAC name is [2-(2-ethylpiperidin-1-yl)-2-oxoethyl] 3-(tert-butylsulfamoyl)-4-chlorobenzoate.
| Compound Name | [2-(2-ethylpiperidin-1-yl)-2-oxoethyl] 3-(tert-butylsulfamoyl)-4-chlorobenzoate |
|---|---|
| PubChem CID | 46791269 |
| Molecular Formula | C20H29ClN2O5S |
| Molecular Weight | 444.98 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | [2-(2-ethylpiperidin-1-yl)-2-oxoethyl] 3-(tert-butylsulfamoyl)-4-chlorobenzoate |
| SMILES | CCC1CCCCN1C(=O)COC(=O)c1ccc(Cl)c(S(=O)(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C20H29ClN2O5S/c1-5-15-8-6-7-11-23(15)18(24)13-28-19(25)14-9-10-16(21)17(12-14)29(26,27)22-20(2,3)4/h9-10,12,15,22H,5-8,11,13H2,1-4H3 |
| InChIKey | YOKFWOGIFPBJPP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.98 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |