C18H23N3O3 — CID 2476351
[2-[(2S)-2-ethylpiperidin-1-yl]-2-oxoethyl] 2-(benzimidazol-1-yl)acetate (PubChem CID 2476351) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is [2-[(2S)-2-ethylpiperidin-1-yl]-2-oxoethyl] 2-(benzimidazol-1-yl)acetate.
| Compound Name | [2-[(2S)-2-ethylpiperidin-1-yl]-2-oxoethyl] 2-(benzimidazol-1-yl)acetate |
|---|---|
| PubChem CID | 2476351 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | [2-[(2S)-2-ethylpiperidin-1-yl]-2-oxoethyl] 2-(benzimidazol-1-yl)acetate |
| SMILES | CC[C@H]1CCCCN1C(=O)COC(=O)Cn1cnc2ccccc21 |
| InChI | InChI=1S/C18H23N3O3/c1-2-14-7-5-6-10-21(14)17(22)12-24-18(23)11-20-13-19-15-8-3-4-9-16(15)20/h3-4,8-9,13-14H,2,5-7,10-12H2,1H3/t14-/m0/s1 |
| InChIKey | AYNCBFKVEXJJOY-AWEZNQCLSA-N |
| XLogP | 2.37 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |