C16H21N5O2 — CID 138995721
1-[2-[2-(benzimidazol-1-ylmethyl)pyrrolidin-1-yl]-2-oxoethyl]-3-methylurea (PubChem CID 138995721) has the molecular formula C16H21N5O2 and a molecular weight of 315.38 g/mol. Its IUPAC name is 1-[2-[2-(benzimidazol-1-ylmethyl)pyrrolidin-1-yl]-2-oxoethyl]-3-methylurea.
| Compound Name | 1-[2-[2-(benzimidazol-1-ylmethyl)pyrrolidin-1-yl]-2-oxoethyl]-3-methylurea |
|---|---|
| PubChem CID | 138995721 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 1-[2-[2-(benzimidazol-1-ylmethyl)pyrrolidin-1-yl]-2-oxoethyl]-3-methylurea |
| SMILES | CNC(=O)NCC(=O)N1CCCC1Cn1cnc2ccccc21 |
| InChI | InChI=1S/C16H21N5O2/c1-17-16(23)18-9-15(22)21-8-4-5-12(21)10-20-11-19-13-6-2-3-7-14(13)20/h2-3,6-7,11-12H,4-5,8-10H2,1H3,(H2,17,18,23) |
| InChIKey | XSFLBYOPAQBMJG-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |