C21H27N3O3 — CID 55441885
[2-(2-ethylpiperidin-1-yl)-2-oxoethyl] 3-(1-phenylpyrazol-4-yl)propanoate (PubChem CID 55441885) has the molecular formula C21H27N3O3 and a molecular weight of 369.46 g/mol. Its IUPAC name is [2-(2-ethylpiperidin-1-yl)-2-oxoethyl] 3-(1-phenylpyrazol-4-yl)propanoate.
| Compound Name | [2-(2-ethylpiperidin-1-yl)-2-oxoethyl] 3-(1-phenylpyrazol-4-yl)propanoate |
|---|---|
| PubChem CID | 55441885 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | [2-(2-ethylpiperidin-1-yl)-2-oxoethyl] 3-(1-phenylpyrazol-4-yl)propanoate |
| SMILES | CCC1CCCCN1C(=O)COC(=O)CCc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C21H27N3O3/c1-2-18-8-6-7-13-23(18)20(25)16-27-21(26)12-11-17-14-22-24(15-17)19-9-4-3-5-10-19/h3-5,9-10,14-15,18H,2,6-8,11-13,16H2,1H3 |
| InChIKey | KPXJUWJIEUTGLM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |