C22H23N3O3S — CID 55441243
[2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 3-(1-phenylpyrazol-4-yl)propanoate (PubChem CID 55441243) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 3-(1-phenylpyrazol-4-yl)propanoate.
| Compound Name | [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 3-(1-phenylpyrazol-4-yl)propanoate |
|---|---|
| PubChem CID | 55441243 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 3-(1-phenylpyrazol-4-yl)propanoate |
| SMILES | O=C(CCc1cnn(-c2ccccc2)c1)OCC(=O)N1CCCC1c1cccs1 |
| InChI | InChI=1S/C22H23N3O3S/c26-21(24-12-4-8-19(24)20-9-5-13-29-20)16-28-22(27)11-10-17-14-23-25(15-17)18-6-2-1-3-7-18/h1-3,5-7,9,13-15,19H,4,8,10-12,16H2 |
| InChIKey | RXXLOKRZUJYFHI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |