C20H25N3O3 — CID 27031247
[2-(cyclohexylamino)-2-oxoethyl] 3-(1-phenylpyrazol-4-yl)propanoate (PubChem CID 27031247) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is [2-(cyclohexylamino)-2-oxoethyl] 3-(1-phenylpyrazol-4-yl)propanoate.
| Compound Name | [2-(cyclohexylamino)-2-oxoethyl] 3-(1-phenylpyrazol-4-yl)propanoate |
|---|---|
| PubChem CID | 27031247 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | [2-(cyclohexylamino)-2-oxoethyl] 3-(1-phenylpyrazol-4-yl)propanoate |
| SMILES | O=C(COC(=O)CCc1cnn(-c2ccccc2)c1)NC1CCCCC1 |
| InChI | InChI=1S/C20H25N3O3/c24-19(22-17-7-3-1-4-8-17)15-26-20(25)12-11-16-13-21-23(14-16)18-9-5-2-6-10-18/h2,5-6,9-10,13-14,17H,1,3-4,7-8,11-12,15H2,(H,22,24) |
| InChIKey | VIGIZFLDDXXMKM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |