C16H18N4O4 — CID 27031416
[2-(methylcarbamoylamino)-2-oxoethyl] 3-(1-phenylpyrazol-4-yl)propanoate (PubChem CID 27031416) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxoethyl] 3-(1-phenylpyrazol-4-yl)propanoate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxoethyl] 3-(1-phenylpyrazol-4-yl)propanoate |
|---|---|
| PubChem CID | 27031416 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxoethyl] 3-(1-phenylpyrazol-4-yl)propanoate |
| SMILES | CNC(=O)NC(=O)COC(=O)CCc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C16H18N4O4/c1-17-16(23)19-14(21)11-24-15(22)8-7-12-9-18-20(10-12)13-5-3-2-4-6-13/h2-6,9-10H,7-8,11H2,1H3,(H2,17,19,21,23) |
| InChIKey | ZNBRGZRMICIZOL-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |