C19H23N3O5 — CID 31022629
ethyl 4-[[2-[2-(1-phenylpyrazol-4-yl)acetyl]oxyacetyl]amino]butanoate (PubChem CID 31022629) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is ethyl 4-[[2-[2-(1-phenylpyrazol-4-yl)acetyl]oxyacetyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-[2-(1-phenylpyrazol-4-yl)acetyl]oxyacetyl]amino]butanoate |
|---|---|
| PubChem CID | 31022629 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | ethyl 4-[[2-[2-(1-phenylpyrazol-4-yl)acetyl]oxyacetyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)COC(=O)Cc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C19H23N3O5/c1-2-26-18(24)9-6-10-20-17(23)14-27-19(25)11-15-12-21-22(13-15)16-7-4-3-5-8-16/h3-5,7-8,12-13H,2,6,9-11,14H2,1H3,(H,20,23) |
| InChIKey | TWJBVCVWFRRINA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|