C21H21N3O3 — CID 31022186
[2-(2,6-dimethylanilino)-2-oxoethyl] 2-(1-phenylpyrazol-4-yl)acetate (PubChem CID 31022186) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is [2-(2,6-dimethylanilino)-2-oxoethyl] 2-(1-phenylpyrazol-4-yl)acetate.
| Compound Name | [2-(2,6-dimethylanilino)-2-oxoethyl] 2-(1-phenylpyrazol-4-yl)acetate |
|---|---|
| PubChem CID | 31022186 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | [2-(2,6-dimethylanilino)-2-oxoethyl] 2-(1-phenylpyrazol-4-yl)acetate |
| SMILES | Cc1cccc(C)c1NC(=O)COC(=O)Cc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C21H21N3O3/c1-15-7-6-8-16(2)21(15)23-19(25)14-27-20(26)11-17-12-22-24(13-17)18-9-4-3-5-10-18/h3-10,12-13H,11,14H2,1-2H3,(H,23,25) |
| InChIKey | DRFDUCVFNONZQN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |