C18H17N3O4 — CID 32932137
[2-(furan-2-ylmethylamino)-2-oxoethyl] 2-(1-phenylpyrazol-4-yl)acetate (PubChem CID 32932137) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is [2-(furan-2-ylmethylamino)-2-oxoethyl] 2-(1-phenylpyrazol-4-yl)acetate.
| Compound Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 2-(1-phenylpyrazol-4-yl)acetate |
|---|---|
| PubChem CID | 32932137 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 2-(1-phenylpyrazol-4-yl)acetate |
| SMILES | O=C(COC(=O)Cc1cnn(-c2ccccc2)c1)NCc1ccco1 |
| InChI | InChI=1S/C18H17N3O4/c22-17(19-11-16-7-4-8-24-16)13-25-18(23)9-14-10-20-21(12-14)15-5-2-1-3-6-15/h1-8,10,12H,9,11,13H2,(H,19,22) |
| InChIKey | MRSGPKYYFHOJQH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |