C20H16Cl3N3O3 — CID 27031215
[2-oxo-2-(2,4,5-trichloroanilino)ethyl] 3-(1-phenylpyrazol-4-yl)propanoate (PubChem CID 27031215) has the molecular formula C20H16Cl3N3O3 and a molecular weight of 452.73 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 3-(1-phenylpyrazol-4-yl)propanoate.
| Compound Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 3-(1-phenylpyrazol-4-yl)propanoate |
|---|---|
| PubChem CID | 27031215 |
| Molecular Formula | C20H16Cl3N3O3 |
| Molecular Weight | 452.73 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 3-(1-phenylpyrazol-4-yl)propanoate |
| SMILES | O=C(COC(=O)CCc1cnn(-c2ccccc2)c1)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C20H16Cl3N3O3/c21-15-8-17(23)18(9-16(15)22)25-19(27)12-29-20(28)7-6-13-10-24-26(11-13)14-4-2-1-3-5-14/h1-5,8-11H,6-7,12H2,(H,25,27) |
| InChIKey | XFPORDBSKZFFDH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.73 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|