C19H16ClFN2O2 — CID 55441869
(2-chloro-6-fluorophenyl)methyl 3-(1-phenylpyrazol-4-yl)propanoate (PubChem CID 55441869) has the molecular formula C19H16ClFN2O2 and a molecular weight of 358.80 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)methyl 3-(1-phenylpyrazol-4-yl)propanoate.
| Compound Name | (2-chloro-6-fluorophenyl)methyl 3-(1-phenylpyrazol-4-yl)propanoate |
|---|---|
| PubChem CID | 55441869 |
| Molecular Formula | C19H16ClFN2O2 |
| Molecular Weight | 358.80 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | (2-chloro-6-fluorophenyl)methyl 3-(1-phenylpyrazol-4-yl)propanoate |
| SMILES | O=C(CCc1cnn(-c2ccccc2)c1)OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C19H16ClFN2O2/c20-17-7-4-8-18(21)16(17)13-25-19(24)10-9-14-11-22-23(12-14)15-5-2-1-3-6-15/h1-8,11-12H,9-10,13H2 |
| InChIKey | ZPHTVVRLWGGPGG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.80 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |