C20H16F2N2O3 — CID 27031347
[2-(3,4-difluorophenyl)-2-oxoethyl] 3-(1-phenylpyrazol-4-yl)propanoate (PubChem CID 27031347) has the molecular formula C20H16F2N2O3 and a molecular weight of 370.36 g/mol. Its IUPAC name is [2-(3,4-difluorophenyl)-2-oxoethyl] 3-(1-phenylpyrazol-4-yl)propanoate.
| Compound Name | [2-(3,4-difluorophenyl)-2-oxoethyl] 3-(1-phenylpyrazol-4-yl)propanoate |
|---|---|
| PubChem CID | 27031347 |
| Molecular Formula | C20H16F2N2O3 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | [2-(3,4-difluorophenyl)-2-oxoethyl] 3-(1-phenylpyrazol-4-yl)propanoate |
| SMILES | O=C(CCc1cnn(-c2ccccc2)c1)OCC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H16F2N2O3/c21-17-8-7-15(10-18(17)22)19(25)13-27-20(26)9-6-14-11-23-24(12-14)16-4-2-1-3-5-16/h1-5,7-8,10-12H,6,9,13H2 |
| InChIKey | LCGLQTWSXNZBJA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |