C15H19Br2NO2 — CID 42885187
2-(2,4-dibromophenoxy)-1-(2-ethylpiperidin-1-yl)ethanone (PubChem CID 42885187) has the molecular formula C15H19Br2NO2 and a molecular weight of 405.13 g/mol. Its IUPAC name is 2-(2,4-dibromophenoxy)-1-(2-ethylpiperidin-1-yl)ethanone.
| Compound Name | 2-(2,4-dibromophenoxy)-1-(2-ethylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 42885187 |
| Molecular Formula | C15H19Br2NO2 |
| Molecular Weight | 405.13 g/mol |
| Exact Mass | 402.98 |
| IUPAC Name | 2-(2,4-dibromophenoxy)-1-(2-ethylpiperidin-1-yl)ethanone |
| SMILES | CCC1CCCCN1C(=O)COc1ccc(Br)cc1Br |
| InChI | InChI=1S/C15H19Br2NO2/c1-2-12-5-3-4-8-18(12)15(19)10-20-14-7-6-11(16)9-13(14)17/h6-7,9,12H,2-5,8,10H2,1H3 |
| InChIKey | ALQCEBFSLBVLDS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.13 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |