C16H22N2O4 — CID 78801167
1-(2-ethylpiperidin-1-yl)-2-(4-methyl-2-nitrophenoxy)ethanone (PubChem CID 78801167) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 1-(2-ethylpiperidin-1-yl)-2-(4-methyl-2-nitrophenoxy)ethanone.
| Compound Name | 1-(2-ethylpiperidin-1-yl)-2-(4-methyl-2-nitrophenoxy)ethanone |
|---|---|
| PubChem CID | 78801167 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 1-(2-ethylpiperidin-1-yl)-2-(4-methyl-2-nitrophenoxy)ethanone |
| SMILES | CCC1CCCCN1C(=O)COc1ccc(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H22N2O4/c1-3-13-6-4-5-9-17(13)16(19)11-22-15-8-7-12(2)10-14(15)18(20)21/h7-8,10,13H,3-6,9,11H2,1-2H3 |
| InChIKey | RCTKHVJPKHRFOZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|