C18H17Br2NO2 — CID 41293959
2-(2,4-dibromophenoxy)-1-[(2S)-2-phenylpyrrolidin-1-yl]ethanone (PubChem CID 41293959) has the molecular formula C18H17Br2NO2 and a molecular weight of 439.15 g/mol. Its IUPAC name is 2-(2,4-dibromophenoxy)-1-[(2S)-2-phenylpyrrolidin-1-yl]ethanone.
| Compound Name | 2-(2,4-dibromophenoxy)-1-[(2S)-2-phenylpyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 41293959 |
| Molecular Formula | C18H17Br2NO2 |
| Molecular Weight | 439.15 g/mol |
| Exact Mass | 436.96 |
| IUPAC Name | 2-(2,4-dibromophenoxy)-1-[(2S)-2-phenylpyrrolidin-1-yl]ethanone |
| SMILES | O=C(COc1ccc(Br)cc1Br)N1CCC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H17Br2NO2/c19-14-8-9-17(15(20)11-14)23-12-18(22)21-10-4-7-16(21)13-5-2-1-3-6-13/h1-3,5-6,8-9,11,16H,4,7,10,12H2/t16-/m0/s1 |
| InChIKey | ZGFLPKKJCJEJJC-INIZCTEOSA-N |
| XLogP | 4.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.15 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |