C12H14ClN3O2 — CID 114693438
2-chloro-6-ethoxy-7-methoxy-N-methylquinazolin-4-amine (PubChem CID 114693438) has the molecular formula C12H14ClN3O2 and a molecular weight of 267.72 g/mol. Its IUPAC name is 2-chloro-6-ethoxy-7-methoxy-N-methylquinazolin-4-amine.
| Compound Name | 2-chloro-6-ethoxy-7-methoxy-N-methylquinazolin-4-amine |
|---|---|
| PubChem CID | 114693438 |
| Molecular Formula | C12H14ClN3O2 |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 2-chloro-6-ethoxy-7-methoxy-N-methylquinazolin-4-amine |
| SMILES | CCOc1cc2c(NC)nc(Cl)nc2cc1OC |
| InChI | InChI=1S/C12H14ClN3O2/c1-4-18-10-5-7-8(6-9(10)17-3)15-12(13)16-11(7)14-2/h5-6H,4H2,1-3H3,(H,14,15,16) |
| InChIKey | OGBVHXCXVYDVHQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |