C16H16ClN3O3 — CID 171562089
2-chloro-6-ethoxy-N-(furan-2-ylmethyl)-7-methoxyquinazolin-4-amine (PubChem CID 171562089) has the molecular formula C16H16ClN3O3 and a molecular weight of 333.78 g/mol. Its IUPAC name is 2-chloro-6-ethoxy-N-(furan-2-ylmethyl)-7-methoxyquinazolin-4-amine.
| Compound Name | 2-chloro-6-ethoxy-N-(furan-2-ylmethyl)-7-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 171562089 |
| Molecular Formula | C16H16ClN3O3 |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2-chloro-6-ethoxy-N-(furan-2-ylmethyl)-7-methoxyquinazolin-4-amine |
| SMILES | CCOc1cc2c(NCc3ccco3)nc(Cl)nc2cc1OC |
| InChI | InChI=1S/C16H16ClN3O3/c1-3-22-14-7-11-12(8-13(14)21-2)19-16(17)20-15(11)18-9-10-5-4-6-23-10/h4-8H,3,9H2,1-2H3,(H,18,19,20) |
| InChIKey | AEMVFUBXXDWICA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |