C13H10ClN3O2 — CID 171561832
2-chloro-4-(furan-2-ylmethylamino)quinazolin-8-ol (PubChem CID 171561832) has the molecular formula C13H10ClN3O2 and a molecular weight of 275.69 g/mol. Its IUPAC name is 2-chloro-4-(furan-2-ylmethylamino)quinazolin-8-ol.
| Compound Name | 2-chloro-4-(furan-2-ylmethylamino)quinazolin-8-ol |
|---|---|
| PubChem CID | 171561832 |
| Molecular Formula | C13H10ClN3O2 |
| Molecular Weight | 275.69 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 2-chloro-4-(furan-2-ylmethylamino)quinazolin-8-ol |
| SMILES | Oc1cccc2c(NCc3ccco3)nc(Cl)nc12 |
| InChI | InChI=1S/C13H10ClN3O2/c14-13-16-11-9(4-1-5-10(11)18)12(17-13)15-7-8-3-2-6-19-8/h1-6,18H,7H2,(H,15,16,17) |
| InChIKey | BNYQGSXHTYQHNL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.69 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |