C16H16ClN3O4 — CID 171562096
2-[2-chloro-4-(furan-2-ylmethylamino)-7-methoxyquinazolin-6-yl]oxyethanol (PubChem CID 171562096) has the molecular formula C16H16ClN3O4 and a molecular weight of 349.77 g/mol. Its IUPAC name is 2-[2-chloro-4-(furan-2-ylmethylamino)-7-methoxyquinazolin-6-yl]oxyethanol.
| Compound Name | 2-[2-chloro-4-(furan-2-ylmethylamino)-7-methoxyquinazolin-6-yl]oxyethanol |
|---|---|
| PubChem CID | 171562096 |
| Molecular Formula | C16H16ClN3O4 |
| Molecular Weight | 349.77 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 2-[2-chloro-4-(furan-2-ylmethylamino)-7-methoxyquinazolin-6-yl]oxyethanol |
| SMILES | COc1cc2nc(Cl)nc(NCc3ccco3)c2cc1OCCO |
| InChI | InChI=1S/C16H16ClN3O4/c1-22-13-8-12-11(7-14(13)24-6-4-21)15(20-16(17)19-12)18-9-10-3-2-5-23-10/h2-3,5,7-8,21H,4,6,9H2,1H3,(H,18,19,20) |
| InChIKey | VKQXGDICWBRLDJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 89.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.77 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |