C17H16ClN3O5 — CID 171562086
3-[2-chloro-4-(furan-2-ylmethylamino)-7-methoxyquinazolin-6-yl]oxypropanoic acid (PubChem CID 171562086) has the molecular formula C17H16ClN3O5 and a molecular weight of 377.78 g/mol. Its IUPAC name is 3-[2-chloro-4-(furan-2-ylmethylamino)-7-methoxyquinazolin-6-yl]oxypropanoic acid.
| Compound Name | 3-[2-chloro-4-(furan-2-ylmethylamino)-7-methoxyquinazolin-6-yl]oxypropanoic acid |
|---|---|
| PubChem CID | 171562086 |
| Molecular Formula | C17H16ClN3O5 |
| Molecular Weight | 377.78 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 3-[2-chloro-4-(furan-2-ylmethylamino)-7-methoxyquinazolin-6-yl]oxypropanoic acid |
| SMILES | COc1cc2nc(Cl)nc(NCc3ccco3)c2cc1OCCC(=O)O |
| InChI | InChI=1S/C17H16ClN3O5/c1-24-13-8-12-11(7-14(13)26-6-4-15(22)23)16(21-17(18)20-12)19-9-10-3-2-5-25-10/h2-3,5,7-8H,4,6,9H2,1H3,(H,22,23)(H,19,20,21) |
| InChIKey | URMGYSXOWLITTA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.78 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |