C19H18ClN3O4 — CID 22693097
2-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]-3-phenylpropanoic acid (PubChem CID 22693097) has the molecular formula C19H18ClN3O4 and a molecular weight of 387.82 g/mol. Its IUPAC name is 2-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]-3-phenylpropanoic acid.
| Compound Name | 2-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 22693097 |
| Molecular Formula | C19H18ClN3O4 |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 2-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]-3-phenylpropanoic acid |
| SMILES | COc1cc2nc(Cl)nc(NC(Cc3ccccc3)C(=O)O)c2cc1OC |
| InChI | InChI=1S/C19H18ClN3O4/c1-26-15-9-12-13(10-16(15)27-2)22-19(20)23-17(12)21-14(18(24)25)8-11-6-4-3-5-7-11/h3-7,9-10,14H,8H2,1-2H3,(H,24,25)(H,21,22,23) |
| InChIKey | UIZSPYKEZDEUGA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |