C13H14ClN3O2 — CID 22693080
2-[(2-chloroquinazolin-4-yl)amino]pentanoic acid (PubChem CID 22693080) has the molecular formula C13H14ClN3O2 and a molecular weight of 279.73 g/mol. Its IUPAC name is 2-[(2-chloroquinazolin-4-yl)amino]pentanoic acid.
| Compound Name | 2-[(2-chloroquinazolin-4-yl)amino]pentanoic acid |
|---|---|
| PubChem CID | 22693080 |
| Molecular Formula | C13H14ClN3O2 |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 2-[(2-chloroquinazolin-4-yl)amino]pentanoic acid |
| SMILES | CCCC(Nc1nc(Cl)nc2ccccc12)C(=O)O |
| InChI | InChI=1S/C13H14ClN3O2/c1-2-5-10(12(18)19)15-11-8-6-3-4-7-9(8)16-13(14)17-11/h3-4,6-7,10H,2,5H2,1H3,(H,18,19)(H,15,16,17) |
| InChIKey | NAVDSDNRRSKQFA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |