C18H24N4O2 — CID 21004110
2-[[2-(pyrrolidin-1-ylmethyl)quinazolin-4-yl]amino]pentanoic acid (PubChem CID 21004110) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 2-[[2-(pyrrolidin-1-ylmethyl)quinazolin-4-yl]amino]pentanoic acid.
| Compound Name | 2-[[2-(pyrrolidin-1-ylmethyl)quinazolin-4-yl]amino]pentanoic acid |
|---|---|
| PubChem CID | 21004110 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 2-[[2-(pyrrolidin-1-ylmethyl)quinazolin-4-yl]amino]pentanoic acid |
| SMILES | CCCC(Nc1nc(CN2CCCC2)nc2ccccc12)C(=O)O |
| InChI | InChI=1S/C18H24N4O2/c1-2-7-15(18(23)24)20-17-13-8-3-4-9-14(13)19-16(21-17)12-22-10-5-6-11-22/h3-4,8-9,15H,2,5-7,10-12H2,1H3,(H,23,24)(H,19,20,21) |
| InChIKey | ZQYPGODUQFZJMU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |