C17H21N5O3 — CID 21004122
4-amino-4-oxo-2-[[2-(pyrrolidin-1-ylmethyl)quinazolin-4-yl]amino]butanoic acid (PubChem CID 21004122) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is 4-amino-4-oxo-2-[[2-(pyrrolidin-1-ylmethyl)quinazolin-4-yl]amino]butanoic acid.
| Compound Name | 4-amino-4-oxo-2-[[2-(pyrrolidin-1-ylmethyl)quinazolin-4-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 21004122 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 4-amino-4-oxo-2-[[2-(pyrrolidin-1-ylmethyl)quinazolin-4-yl]amino]butanoic acid |
| SMILES | NC(=O)CC(Nc1nc(CN2CCCC2)nc2ccccc12)C(=O)O |
| InChI | InChI=1S/C17H21N5O3/c18-14(23)9-13(17(24)25)20-16-11-5-1-2-6-12(11)19-15(21-16)10-22-7-3-4-8-22/h1-2,5-6,13H,3-4,7-10H2,(H2,18,23)(H,24,25)(H,19,20,21) |
| InChIKey | BNEYKGYFBBDJBC-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |