C19H16F3N3O2 — CID 21003630
2-[[6-methyl-2-(trifluoromethyl)quinazolin-4-yl]amino]-3-phenylpropanoic acid (PubChem CID 21003630) has the molecular formula C19H16F3N3O2 and a molecular weight of 375.35 g/mol. Its IUPAC name is 2-[[6-methyl-2-(trifluoromethyl)quinazolin-4-yl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[6-methyl-2-(trifluoromethyl)quinazolin-4-yl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 21003630 |
| Molecular Formula | C19H16F3N3O2 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 2-[[6-methyl-2-(trifluoromethyl)quinazolin-4-yl]amino]-3-phenylpropanoic acid |
| SMILES | Cc1ccc2nc(C(F)(F)F)nc(NC(Cc3ccccc3)C(=O)O)c2c1 |
| InChI | InChI=1S/C19H16F3N3O2/c1-11-7-8-14-13(9-11)16(25-18(24-14)19(20,21)22)23-15(17(26)27)10-12-5-3-2-4-6-12/h2-9,15H,10H2,1H3,(H,26,27)(H,23,24,25) |
| InChIKey | LMYXLHNDEZHMJH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |