C15H16F3N3O3S — CID 21003737
2-[[7-methoxy-2-(trifluoromethyl)quinazolin-4-yl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 21003737) has the molecular formula C15H16F3N3O3S and a molecular weight of 375.37 g/mol. Its IUPAC name is 2-[[7-methoxy-2-(trifluoromethyl)quinazolin-4-yl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[7-methoxy-2-(trifluoromethyl)quinazolin-4-yl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 21003737 |
| Molecular Formula | C15H16F3N3O3S |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 2-[[7-methoxy-2-(trifluoromethyl)quinazolin-4-yl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | COc1ccc2c(NC(CCSC)C(=O)O)nc(C(F)(F)F)nc2c1 |
| InChI | InChI=1S/C15H16F3N3O3S/c1-24-8-3-4-9-11(7-8)20-14(15(16,17)18)21-12(9)19-10(13(22)23)5-6-25-2/h3-4,7,10H,5-6H2,1-2H3,(H,22,23)(H,19,20,21) |
| InChIKey | BMRHLLJBACKOFT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |