C16H18F3N3O4 — CID 21003476
2-[[6,7-dimethoxy-2-(trifluoromethyl)quinazolin-4-yl]amino]pentanoic acid (PubChem CID 21003476) has the molecular formula C16H18F3N3O4 and a molecular weight of 373.33 g/mol. Its IUPAC name is 2-[[6,7-dimethoxy-2-(trifluoromethyl)quinazolin-4-yl]amino]pentanoic acid.
| Compound Name | 2-[[6,7-dimethoxy-2-(trifluoromethyl)quinazolin-4-yl]amino]pentanoic acid |
|---|---|
| PubChem CID | 21003476 |
| Molecular Formula | C16H18F3N3O4 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 2-[[6,7-dimethoxy-2-(trifluoromethyl)quinazolin-4-yl]amino]pentanoic acid |
| SMILES | CCCC(Nc1nc(C(F)(F)F)nc2cc(OC)c(OC)cc12)C(=O)O |
| InChI | InChI=1S/C16H18F3N3O4/c1-4-5-9(14(23)24)20-13-8-6-11(25-2)12(26-3)7-10(8)21-15(22-13)16(17,18)19/h6-7,9H,4-5H2,1-3H3,(H,23,24)(H,20,21,22) |
| InChIKey | REKOHTZVHCJFOS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |