C18H16F3N3O2 — CID 21003392
N-benzyl-6,7-dimethoxy-2-(trifluoromethyl)quinazolin-4-amine (PubChem CID 21003392) has the molecular formula C18H16F3N3O2 and a molecular weight of 363.34 g/mol. Its IUPAC name is N-benzyl-6,7-dimethoxy-2-(trifluoromethyl)quinazolin-4-amine.
| Compound Name | N-benzyl-6,7-dimethoxy-2-(trifluoromethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 21003392 |
| Molecular Formula | C18H16F3N3O2 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | N-benzyl-6,7-dimethoxy-2-(trifluoromethyl)quinazolin-4-amine |
| SMILES | COc1cc2nc(C(F)(F)F)nc(NCc3ccccc3)c2cc1OC |
| InChI | InChI=1S/C18H16F3N3O2/c1-25-14-8-12-13(9-15(14)26-2)23-17(18(19,20)21)24-16(12)22-10-11-6-4-3-5-7-11/h3-9H,10H2,1-2H3,(H,22,23,24) |
| InChIKey | UDZFOISPVJDBTK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |