C26H25N3O2 — CID 169133029
2-cyclopropyl-6,7-dimethoxy-N-[(4-phenylphenyl)methyl]quinazolin-4-amine (PubChem CID 169133029) has the molecular formula C26H25N3O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 2-cyclopropyl-6,7-dimethoxy-N-[(4-phenylphenyl)methyl]quinazolin-4-amine.
| Compound Name | 2-cyclopropyl-6,7-dimethoxy-N-[(4-phenylphenyl)methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 169133029 |
| Molecular Formula | C26H25N3O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 2-cyclopropyl-6,7-dimethoxy-N-[(4-phenylphenyl)methyl]quinazolin-4-amine |
| SMILES | COc1cc2nc(C3CC3)nc(NCc3ccc(-c4ccccc4)cc3)c2cc1OC |
| InChI | InChI=1S/C26H25N3O2/c1-30-23-14-21-22(15-24(23)31-2)28-25(20-12-13-20)29-26(21)27-16-17-8-10-19(11-9-17)18-6-4-3-5-7-18/h3-11,14-15,20H,12-13,16H2,1-2H3,(H,27,28,29) |
| InChIKey | WZFZRPURVBDRNL-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |