C15H18F3N3O2 — CID 21003434
N-tert-butyl-6,7-dimethoxy-2-(trifluoromethyl)quinazolin-4-amine (PubChem CID 21003434) has the molecular formula C15H18F3N3O2 and a molecular weight of 329.32 g/mol. Its IUPAC name is N-tert-butyl-6,7-dimethoxy-2-(trifluoromethyl)quinazolin-4-amine.
| Compound Name | N-tert-butyl-6,7-dimethoxy-2-(trifluoromethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 21003434 |
| Molecular Formula | C15H18F3N3O2 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | N-tert-butyl-6,7-dimethoxy-2-(trifluoromethyl)quinazolin-4-amine |
| SMILES | COc1cc2nc(C(F)(F)F)nc(NC(C)(C)C)c2cc1OC |
| InChI | InChI=1S/C15H18F3N3O2/c1-14(2,3)21-12-8-6-10(22-4)11(23-5)7-9(8)19-13(20-12)15(16,17)18/h6-7H,1-5H3,(H,19,20,21) |
| InChIKey | VULHDPWTQWZAOM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |