C19H25F3N4O2 — CID 21003457
6,7-dimethoxy-N-(4-pyrrolidin-1-ylbutyl)-2-(trifluoromethyl)quinazolin-4-amine (PubChem CID 21003457) has the molecular formula C19H25F3N4O2 and a molecular weight of 398.43 g/mol. Its IUPAC name is 6,7-dimethoxy-N-(4-pyrrolidin-1-ylbutyl)-2-(trifluoromethyl)quinazolin-4-amine.
| Compound Name | 6,7-dimethoxy-N-(4-pyrrolidin-1-ylbutyl)-2-(trifluoromethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 21003457 |
| Molecular Formula | C19H25F3N4O2 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 6,7-dimethoxy-N-(4-pyrrolidin-1-ylbutyl)-2-(trifluoromethyl)quinazolin-4-amine |
| SMILES | COc1cc2nc(C(F)(F)F)nc(NCCCCN3CCCC3)c2cc1OC |
| InChI | InChI=1S/C19H25F3N4O2/c1-27-15-11-13-14(12-16(15)28-2)24-18(19(20,21)22)25-17(13)23-7-3-4-8-26-9-5-6-10-26/h11-12H,3-10H2,1-2H3,(H,23,24,25) |
| InChIKey | AOAUPWBOZJLYPM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|