C31H39N5O2 — CID 10229490
N-[5-(4-ethylpiperazin-1-yl)pentyl]-6,7-dimethoxy-2-naphthalen-2-ylquinazolin-4-amine (PubChem CID 10229490) has the molecular formula C31H39N5O2 and a molecular weight of 513.69 g/mol. Its IUPAC name is N-[5-(4-ethylpiperazin-1-yl)pentyl]-6,7-dimethoxy-2-naphthalen-2-ylquinazolin-4-amine.
| Compound Name | N-[5-(4-ethylpiperazin-1-yl)pentyl]-6,7-dimethoxy-2-naphthalen-2-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 10229490 |
| Molecular Formula | C31H39N5O2 |
| Molecular Weight | 513.69 g/mol |
| Exact Mass | 513.31 |
| IUPAC Name | N-[5-(4-ethylpiperazin-1-yl)pentyl]-6,7-dimethoxy-2-naphthalen-2-ylquinazolin-4-amine |
| SMILES | CCN1CCN(CCCCCNc2nc(-c3ccc4ccccc4c3)nc3cc(OC)c(OC)cc23)CC1 |
| InChI | InChI=1S/C31H39N5O2/c1-4-35-16-18-36(19-17-35)15-9-5-8-14-32-31-26-21-28(37-2)29(38-3)22-27(26)33-30(34-31)25-13-12-23-10-6-7-11-24(23)20-25/h6-7,10-13,20-22H,4-5,8-9,14-19H2,1-3H3,(H,32,33,34) |
| InChIKey | GNQHXZOTCPEVJP-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.69 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|